C3N3O9S3-3 — CID 158016627
1,3,5-triazine-2,4,6-trisulfonate (PubChem CID 158016627) has the molecular formula C3N3O9S3-3 and a molecular weight of 318.25 g/mol. Its IUPAC name is 1,3,5-triazine-2,4,6-trisulfonate.
| Compound Name | 1,3,5-triazine-2,4,6-trisulfonate |
|---|---|
| PubChem CID | 158016627 |
| Molecular Formula | C3N3O9S3-3 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.88 |
| IUPAC Name | 1,3,5-triazine-2,4,6-trisulfonate |
| SMILES | O=S(=O)([O-])c1nc(S(=O)(=O)[O-])nc(S(=O)(=O)[O-])n1 |
| InChI | InChI=1S/C3H3N3O9S3/c7-16(8,9)1-4-2(17(10,11)12)6-3(5-1)18(13,14)15/h(H,7,8,9)(H,10,11,12)(H,13,14,15)/p-3 |
| InChIKey | FFNXJNJCOZGLBM-UHFFFAOYSA-K |
| XLogP | -3.42 |
| TPSA | 210.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|