About potassium;urea;chlorate
potassium;urea;chlorate (PubChem CID 158017922) has the molecular formula CH4ClKN2O4
and a molecular weight of 182.60 g/mol. Its IUPAC name is potassium;urea;chlorate.
Molecular Properties
| Compound Name | potassium;urea;chlorate |
| PubChem CID | 158017922 |
| Molecular Formula | CH4ClKN2O4 |
| Molecular Weight | 182.60 g/mol |
| Exact Mass | 181.95 |
| IUPAC Name | potassium;urea;chlorate |
| SMILES | NC(N)=O.[K+].[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/CH4N2O.ClO3.K/c2*2-1(3)4;/h(H4,2,3,4);;/q;-1;+1 |
| InChIKey | QEDKZMLMLYXCCW-UHFFFAOYSA-N |
| XLogP | -7.54 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.60 |
| LogP ≤ 5 | -7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium;urea;chlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;urea;chlorate?
The IUPAC name of potassium;urea;chlorate (CID 158017922) is potassium;urea;chlorate.
What is the SMILES notation for potassium;urea;chlorate?
The canonical SMILES for potassium;urea;chlorate is NC(N)=O.[K+].[O-][Cl+2]([O-])[O-].
What is the InChIKey of potassium;urea;chlorate?
The InChIKey is QEDKZMLMLYXCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.ClO3.K/c2*2-1(3)4;/h(H4,2,3,4);;/q;-1;+1.
What are the key properties of potassium;urea;chlorate?
potassium;urea;chlorate has a molecular weight of 182.60 g/mol, XLogP of -7.54, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;urea;chlorate is sourced from PubChem (CID 158017922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).