About 1H-imidazole;2-nitropyridine
1H-imidazole;2-nitropyridine (PubChem CID 158018318) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 1H-imidazole;2-nitropyridine.
Molecular Properties
| Compound Name | 1H-imidazole;2-nitropyridine |
| PubChem CID | 158018318 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1H-imidazole;2-nitropyridine |
| SMILES | O=[N+]([O-])c1ccccn1.c1c[nH]cn1 |
| InChI | InChI=1S/C5H4N2O2.C3H4N2/c8-7(9)5-3-1-2-4-6-5;1-2-5-3-4-1/h1-4H;1-3H,(H,4,5) |
| InChIKey | FFTDIKWODKYSQT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;2-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;2-nitropyridine?
The IUPAC name of 1H-imidazole;2-nitropyridine (CID 158018318) is 1H-imidazole;2-nitropyridine.
What is the SMILES notation for 1H-imidazole;2-nitropyridine?
The canonical SMILES for 1H-imidazole;2-nitropyridine is O=[N+]([O-])c1ccccn1.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;2-nitropyridine?
The InChIKey is FFTDIKWODKYSQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2.C3H4N2/c8-7(9)5-3-1-2-4-6-5;1-2-5-3-4-1/h1-4H;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;2-nitropyridine?
1H-imidazole;2-nitropyridine has a molecular weight of 192.18 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;2-nitropyridine is sourced from PubChem (CID 158018318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).