C33H37N5O4 — CID 158018485
N-(4-methoxyphenyl)-2-[7-[[3-[(4-methoxyphenyl)carbamoyl]-2-pyridinyl]amino]heptyl]pyridine-3-carboxamide (PubChem CID 158018485) has the molecular formula C33H37N5O4 and a molecular weight of 567.69 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[7-[[3-[(4-methoxyphenyl)carbamoyl]-2-pyridinyl]amino]heptyl]pyridine-3-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-[7-[[3-[(4-methoxyphenyl)carbamoyl]-2-pyridinyl]amino]heptyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158018485 |
| Molecular Formula | C33H37N5O4 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[7-[[3-[(4-methoxyphenyl)carbamoyl]-2-pyridinyl]amino]heptyl]pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccnc2CCCCCCCNc2ncccc2C(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H37N5O4/c1-41-26-17-13-24(14-18-26)37-32(39)28-10-8-22-34-30(28)12-6-4-3-5-7-21-35-31-29(11-9-23-36-31)33(40)38-25-15-19-27(42-2)20-16-25/h8-11,13-20,22-23H,3-7,12,21H2,1-2H3,(H,35,36)(H,37,39)(H,38,40) |
| InChIKey | FFTQXNRBZSLRIT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|