C63H57F6N15O3 — CID 158019572
2-[3-amino-6-(4-fluorophenyl)-2-pyridinyl]-1-(3-fluoro-3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 158019572) has the molecular formula C63H57F6N15O3 and a molecular weight of 1186.24 g/mol. Its IUPAC name is 2-[3-amino-6-(4-fluorophenyl)-2-pyridinyl]-1-(3-fluoro-3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2-[3-amino-6-(4-fluorophenyl)-2-pyridinyl]-1-(3-fluoro-3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 158019572 |
| Molecular Formula | C63H57F6N15O3 |
| Molecular Weight | 1186.24 g/mol |
| Exact Mass | 1185.47 |
| IUPAC Name | 2-[3-amino-6-(4-fluorophenyl)-2-pyridinyl]-1-(3-fluoro-3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | Nc1ccc(-c2ccc(F)cc2)nc1CC(=O)N1CCC(F)(c2ncccn2)C1.Nc1ccc(-c2ccc(F)cc2)nc1CC(=O)N1CCC(F)(c2ncccn2)C1.Nc1ccc(-c2ccc(F)cc2)nc1CC(=O)N1CCC(F)(c2ncccn2)C1 |
| InChI | InChI=1S/3C21H19F2N5O/c3*22-15-4-2-14(3-5-15)17-7-6-16(24)18(27-17)12-19(29)28-11-8-21(23,13-28)20-25-9-1-10-26-20/h3*1-7,9-10H,8,11-13,24H2 |
| InChIKey | FFWWSLZQBFTWFY-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 255.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1186.24 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |