C41H59N3O6P2 — CID 158019722
3-diethoxyphosphorylpropylbenzene;diethyl hydrogen phosphite;1,3,5-tribenzyl-1,3,5-triazinane (PubChem CID 158019722) has the molecular formula C41H59N3O6P2 and a molecular weight of 751.89 g/mol. Its IUPAC name is 3-diethoxyphosphorylpropylbenzene;diethyl hydrogen phosphite;1,3,5-tribenzyl-1,3,5-triazinane.
| Compound Name | 3-diethoxyphosphorylpropylbenzene;diethyl hydrogen phosphite;1,3,5-tribenzyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 158019722 |
| Molecular Formula | C41H59N3O6P2 |
| Molecular Weight | 751.89 g/mol |
| Exact Mass | 751.39 |
| IUPAC Name | 3-diethoxyphosphorylpropylbenzene;diethyl hydrogen phosphite;1,3,5-tribenzyl-1,3,5-triazinane |
| SMILES | CCOP(=O)(CCCc1ccccc1)OCC.CCOP(O)OCC.c1ccc(CN2CN(Cc3ccccc3)CN(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C24H27N3.C13H21O3P.C4H11O3P/c1-4-10-22(11-5-1)16-25-19-26(17-23-12-6-2-7-13-23)21-27(20-25)18-24-14-8-3-9-15-24;1-3-15-17(14,16-4-2)12-8-11-13-9-6-5-7-10-13;1-3-6-8(5)7-4-2/h1-15H,16-21H2;5-7,9-10H,3-4,8,11-12H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | FFXKNIHTOLVDTA-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.89 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|