C44H30F2N4P2 — CID 15802022
2,5-difluoro-4,6-bis[(triphenyl-lambda5-phosphanylidene)amino]benzene-1,3-dicarbonitrile (PubChem CID 15802022) has the molecular formula C44H30F2N4P2 and a molecular weight of 714.70 g/mol. Its IUPAC name is 2,5-difluoro-4,6-bis[(triphenyl-lambda5-phosphanylidene)amino]benzene-1,3-dicarbonitrile.
| Compound Name | 2,5-difluoro-4,6-bis[(triphenyl-lambda5-phosphanylidene)amino]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 15802022 |
| Molecular Formula | C44H30F2N4P2 |
| Molecular Weight | 714.70 g/mol |
| Exact Mass | 714.19 |
| IUPAC Name | 2,5-difluoro-4,6-bis[(triphenyl-lambda5-phosphanylidene)amino]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(C#N)c(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H30F2N4P2/c45-41-39(31-47)43(49-51(33-19-7-1-8-20-33,34-21-9-2-10-22-34)35-23-11-3-12-24-35)42(46)44(40(41)32-48)50-52(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30H |
| InChIKey | XEIZJZJKDDXNOW-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.70 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|