C34H33Cl2F3N6O3 — CID 158020311
2,6-dichloro-N-[4-[(3S)-piperidin-3-yl]phenyl]pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 158020311) has the molecular formula C34H33Cl2F3N6O3 and a molecular weight of 701.58 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[(3S)-piperidin-3-yl]phenyl]pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[4-[(3S)-piperidin-3-yl]phenyl]pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 158020311 |
| Molecular Formula | C34H33Cl2F3N6O3 |
| Molecular Weight | 701.58 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | 2,6-dichloro-N-[4-[(3S)-piperidin-3-yl]phenyl]pyridine-4-carboxamide;N-(4-morpholin-2-ylphenyl)-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C2CNCCO2)cc1)c1ccnc(C(F)(F)F)c1.O=C(Nc1ccc([C@@H]2CCCNC2)cc1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O.C17H16F3N3O2/c18-15-8-13(9-16(19)22-15)17(23)21-14-5-3-11(4-6-14)12-2-1-7-20-10-12;18-17(19,20)15-9-12(5-6-22-15)16(24)23-13-3-1-11(2-4-13)14-10-21-7-8-25-14/h3-6,8-9,12,20H,1-2,7,10H2,(H,21,23);1-6,9,14,21H,7-8,10H2,(H,23,24)/t12-;/m1./s1 |
| InChIKey | FFZDDSHPDCXWAE-UTONKHPSSA-N |
| XLogP | 7.12 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|