About tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene
tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene (PubChem CID 158020403) has the molecular formula C27H40O4
and a molecular weight of 428.61 g/mol. Its IUPAC name is tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene.
Molecular Properties
| Compound Name | tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene |
| PubChem CID | 158020403 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene |
| SMILES | CC.CC(C)C(=O)OC(C)(C)C.CC(C)OCC1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C17H18O2.C8H16O2.C2H6/c1-12(2)18-11-15-13-7-3-5-9-16(13)19-17-10-6-4-8-14(15)17;1-6(2)7(9)10-8(3,4)5;1-2/h3-10,12,15H,11H2,1-2H3;6H,1-5H3;1-2H3 |
| InChIKey | FFZKQDLWVCIHQB-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene?
The IUPAC name of tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene (CID 158020403) is tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene.
What is the SMILES notation for tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene?
The canonical SMILES for tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene is CC.CC(C)C(=O)OC(C)(C)C.CC(C)OCC1c2ccccc2Oc2ccccc21.
What is the InChIKey of tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene?
The InChIKey is FFZKQDLWVCIHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2.C8H16O2.C2H6/c1-12(2)18-11-15-13-7-3-5-9-16(13)19-17-10-6-4-8-14(15)17;1-6(2)7(9)10-8(3,4)5;1-2/h3-10,12,15H,11H2,1-2H3;6H,1-5H3;1-2H3.
What are the key properties of tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene?
tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene has a molecular weight of 428.61 g/mol, XLogP of 7.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methylpropanoate;ethane;9-(propan-2-yloxymethyl)-9H-xanthene is sourced from PubChem (CID 158020403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).