C8H18N2O7S2 — CID 158020559
4-hydroxypent-4-ene-1-sulfonamide;3-sulfamoylpropanoic acid (PubChem CID 158020559) has the molecular formula C8H18N2O7S2 and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-hydroxypent-4-ene-1-sulfonamide;3-sulfamoylpropanoic acid.
| Compound Name | 4-hydroxypent-4-ene-1-sulfonamide;3-sulfamoylpropanoic acid |
|---|---|
| PubChem CID | 158020559 |
| Molecular Formula | C8H18N2O7S2 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-hydroxypent-4-ene-1-sulfonamide;3-sulfamoylpropanoic acid |
| SMILES | C=C(O)CCCS(N)(=O)=O.NS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C5H11NO3S.C3H7NO4S/c1-5(7)3-2-4-10(6,8)9;4-9(7,8)2-1-3(5)6/h7H,1-4H2,(H2,6,8,9);1-2H2,(H,5,6)(H2,4,7,8) |
| InChIKey | FFZWNOSOWWOADB-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 177.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|