C27H33O6PS2 — CID 158020624
[3-[[2,5-dimethyl-3-(sulfomethyl)phenyl]-(2,3,5-trimethylphenyl)phosphanyl]-2,5-dimethylphenyl]methanesulfonic acid (PubChem CID 158020624) has the molecular formula C27H33O6PS2 and a molecular weight of 548.66 g/mol. Its IUPAC name is [3-[[2,5-dimethyl-3-(sulfomethyl)phenyl]-(2,3,5-trimethylphenyl)phosphanyl]-2,5-dimethylphenyl]methanesulfonic acid.
| Compound Name | [3-[[2,5-dimethyl-3-(sulfomethyl)phenyl]-(2,3,5-trimethylphenyl)phosphanyl]-2,5-dimethylphenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 158020624 |
| Molecular Formula | C27H33O6PS2 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | [3-[[2,5-dimethyl-3-(sulfomethyl)phenyl]-(2,3,5-trimethylphenyl)phosphanyl]-2,5-dimethylphenyl]methanesulfonic acid |
| SMILES | Cc1cc(C)c(C)c(P(c2cc(C)cc(CS(=O)(=O)O)c2C)c2cc(C)cc(CS(=O)(=O)O)c2C)c1 |
| InChI | InChI=1S/C27H33O6PS2/c1-16-8-19(4)20(5)25(11-16)34(26-12-17(2)9-23(21(26)6)14-35(28,29)30)27-13-18(3)10-24(22(27)7)15-36(31,32)33/h8-13H,14-15H2,1-7H3,(H,28,29,30)(H,31,32,33) |
| InChIKey | CXZYYLUNBGGWFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|