C21H29BI2N2O3 — CID 158020743
CID 158020743 (PubChem CID 158020743) has the molecular formula C21H29BI2N2O3 and a molecular weight of 622.09 g/mol.
| Compound Name | CID 158020743 |
|---|---|
| PubChem CID | 158020743 |
| Molecular Formula | C21H29BI2N2O3 |
| Molecular Weight | 622.09 g/mol |
| Exact Mass | 622.04 |
| IUPAC Name | — |
| SMILES | CC(C)(CN)Oc1ccc(I)cc1.CC(C)(Oc1ccc(I)cc1)C(N)=O.[B]C |
| InChI | InChI=1S/C10H12INO2.C10H14INO.CH3B/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8;1-10(2,7-12)13-9-5-3-8(11)4-6-9;1-2/h3-6H,1-2H3,(H2,12,13);3-6H,7,12H2,1-2H3;1H3 |
| InChIKey | AJNIKNCBJZZYPO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.09 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|