C31H36F3N5O3 — CID 158021598
(4R,7S)-1-cyclopentyl-4-propyl-8-(1H-1,2,4-triazol-5-yl)-7-[[(1S)-2,2,2-trifluoro-1-(4-pyridin-3-ylphenyl)ethyl]amino]octane-2,3,6-trione (PubChem CID 158021598) has the molecular formula C31H36F3N5O3 and a molecular weight of 583.66 g/mol. Its IUPAC name is (4R,7S)-1-cyclopentyl-4-propyl-8-(1H-1,2,4-triazol-5-yl)-7-[[(1S)-2,2,2-trifluoro-1-(4-pyridin-3-ylphenyl)ethyl]amino]octane-2,3,6-trione.
| Compound Name | (4R,7S)-1-cyclopentyl-4-propyl-8-(1H-1,2,4-triazol-5-yl)-7-[[(1S)-2,2,2-trifluoro-1-(4-pyridin-3-ylphenyl)ethyl]amino]octane-2,3,6-trione |
|---|---|
| PubChem CID | 158021598 |
| Molecular Formula | C31H36F3N5O3 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | (4R,7S)-1-cyclopentyl-4-propyl-8-(1H-1,2,4-triazol-5-yl)-7-[[(1S)-2,2,2-trifluoro-1-(4-pyridin-3-ylphenyl)ethyl]amino]octane-2,3,6-trione |
| SMILES | CCC[C@H](CC(=O)[C@H](Cc1ncn[nH]1)N[C@@H](c1ccc(-c2cccnc2)cc1)C(F)(F)F)C(=O)C(=O)CC1CCCC1 |
| InChI | InChI=1S/C31H36F3N5O3/c1-2-6-23(29(42)27(41)15-20-7-3-4-8-20)16-26(40)25(17-28-36-19-37-39-28)38-30(31(32,33)34)22-12-10-21(11-13-22)24-9-5-14-35-18-24/h5,9-14,18-20,23,25,30,38H,2-4,6-8,15-17H2,1H3,(H,36,37,39)/t23-,25+,30+/m1/s1 |
| InChIKey | TXAAYWFPOJONAY-BWQBABIRSA-N |
| XLogP | 5.76 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|