About ethene;1-pyrrolidin-1-ylpropan-1-one
ethene;1-pyrrolidin-1-ylpropan-1-one (PubChem CID 158024233) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is ethene;1-pyrrolidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | ethene;1-pyrrolidin-1-ylpropan-1-one |
| PubChem CID | 158024233 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | ethene;1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C=C.CCC(=O)N1CCCC1 |
| InChI | InChI=1S/C7H13NO.C2H4/c1-2-7(9)8-5-3-4-6-8;1-2/h2-6H2,1H3;1-2H2 |
| InChIKey | FGKNIKAUYMHWBA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-pyrrolidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-pyrrolidin-1-ylpropan-1-one?
The IUPAC name of ethene;1-pyrrolidin-1-ylpropan-1-one (CID 158024233) is ethene;1-pyrrolidin-1-ylpropan-1-one.
What is the SMILES notation for ethene;1-pyrrolidin-1-ylpropan-1-one?
The canonical SMILES for ethene;1-pyrrolidin-1-ylpropan-1-one is C=C.CCC(=O)N1CCCC1.
What is the InChIKey of ethene;1-pyrrolidin-1-ylpropan-1-one?
The InChIKey is FGKNIKAUYMHWBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C2H4/c1-2-7(9)8-5-3-4-6-8;1-2/h2-6H2,1H3;1-2H2.
What are the key properties of ethene;1-pyrrolidin-1-ylpropan-1-one?
ethene;1-pyrrolidin-1-ylpropan-1-one has a molecular weight of 155.24 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-pyrrolidin-1-ylpropan-1-one is sourced from PubChem (CID 158024233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).