About (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium
(2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium (PubChem CID 158024680) has the molecular formula C15H19NO2Y
and a molecular weight of 334.23 g/mol. Its IUPAC name is (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium.
Molecular Properties
| Compound Name | (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium |
| PubChem CID | 158024680 |
| Molecular Formula | C15H19NO2Y |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium |
| SMILES | Cc1cc2c(c(C)c1N(C)C)CC/C2=C/C(=O)O.[Y] |
| InChI | InChI=1S/C15H19NO2.Y/c1-9-7-13-11(8-14(17)18)5-6-12(13)10(2)15(9)16(3)4;/h7-8H,5-6H2,1-4H3,(H,17,18);/b11-8-; |
| InChIKey | ORIVLEVSLIEUCP-MKFZHGHUSA-N |
| XLogP | 2.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium?
The IUPAC name of (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium (CID 158024680) is (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium.
What is the SMILES notation for (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium?
The canonical SMILES for (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium is Cc1cc2c(c(C)c1N(C)C)CC/C2=C/C(=O)O.[Y].
What is the InChIKey of (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium?
The InChIKey is ORIVLEVSLIEUCP-MKFZHGHUSA-N. The full InChI is InChI=1S/C15H19NO2.Y/c1-9-7-13-11(8-14(17)18)5-6-12(13)10(2)15(9)16(3)4;/h7-8H,5-6H2,1-4H3,(H,17,18);/b11-8-;.
What are the key properties of (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium?
(2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium has a molecular weight of 334.23 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[5-(dimethylamino)-4,6-dimethyl-2,3-dihydroinden-1-ylidene]acetic acid;yttrium is sourced from PubChem (CID 158024680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).