About 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione
2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione (PubChem CID 158025071) has the molecular formula C18H27NS
and a molecular weight of 289.49 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione.
Molecular Properties
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione |
| PubChem CID | 158025071 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione |
| SMILES | CC(C)c1cccc(C(C)C)c1CC(=S)N1CCCC1 |
| InChI | InChI=1S/C18H27NS/c1-13(2)15-8-7-9-16(14(3)4)17(15)12-18(20)19-10-5-6-11-19/h7-9,13-14H,5-6,10-12H2,1-4H3 |
| InChIKey | WHZITXFTVJDJCL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione?
The IUPAC name of 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione (CID 158025071) is 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione.
What is the SMILES notation for 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione?
The canonical SMILES for 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione is CC(C)c1cccc(C(C)C)c1CC(=S)N1CCCC1.
What is the InChIKey of 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione?
The InChIKey is WHZITXFTVJDJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NS/c1-13(2)15-8-7-9-16(14(3)4)17(15)12-18(20)19-10-5-6-11-19/h7-9,13-14H,5-6,10-12H2,1-4H3.
What are the key properties of 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione?
2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione has a molecular weight of 289.49 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-di(propan-2-yl)phenyl]-1-pyrrolidin-1-ylethanethione is sourced from PubChem (CID 158025071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).