About 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol
10H-indeno[1,2-b][1]benzofuran-3-ylmethanol (PubChem CID 158025495) has the molecular formula C16H12O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol.
Molecular Properties
| Compound Name | 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol |
| PubChem CID | 158025495 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol |
| SMILES | OCc1ccc2c(c1)-c1oc3ccccc3c1C2 |
| InChI | InChI=1S/C16H12O2/c17-9-10-5-6-11-8-14-12-3-1-2-4-15(12)18-16(14)13(11)7-10/h1-7,17H,8-9H2 |
| InChIKey | FGOFKGVNIPQIKO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol?
The IUPAC name of 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol (CID 158025495) is 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol.
What is the SMILES notation for 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol?
The canonical SMILES for 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol is OCc1ccc2c(c1)-c1oc3ccccc3c1C2.
What is the InChIKey of 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol?
The InChIKey is FGOFKGVNIPQIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O2/c17-9-10-5-6-11-8-14-12-3-1-2-4-15(12)18-16(14)13(11)7-10/h1-7,17H,8-9H2.
What are the key properties of 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol?
10H-indeno[1,2-b][1]benzofuran-3-ylmethanol has a molecular weight of 236.27 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-indeno[1,2-b][1]benzofuran-3-ylmethanol is sourced from PubChem (CID 158025495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).