C23H25N5O2 — CID 158026128
4-[(2S,5S)-2,5-dimethyl-4-(3-methylphenoxy)piperidin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one (PubChem CID 158026128) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-[(2S,5S)-2,5-dimethyl-4-(3-methylphenoxy)piperidin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 4-[(2S,5S)-2,5-dimethyl-4-(3-methylphenoxy)piperidin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 158026128 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-[(2S,5S)-2,5-dimethyl-4-(3-methylphenoxy)piperidin-1-yl]-6-isocyano-1-methylpyrido[3,2-d]pyrimidin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1C[C@H](C)C(Oc3cccc(C)c3)C[C@@H]1C)nc(=O)n2C |
| InChI | InChI=1S/C23H25N5O2/c1-14-7-6-8-17(11-14)30-19-12-16(3)28(13-15(19)2)22-21-18(27(5)23(29)26-22)9-10-20(24-4)25-21/h6-11,15-16,19H,12-13H2,1-3,5H3/t15-,16-,19?/m0/s1 |
| InChIKey | FGPYNIFMZRDINW-NRAVZPKASA-N |
| XLogP | 3.87 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|