C26H28N4O4 — CID 158026407
2,3-bis[[2-hydroxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]but-2-enedinitrile (PubChem CID 158026407) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2,3-bis[[2-hydroxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]but-2-enedinitrile.
| Compound Name | 2,3-bis[[2-hydroxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]but-2-enedinitrile |
|---|---|
| PubChem CID | 158026407 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2,3-bis[[2-hydroxy-4-[(2-methylpropan-2-yl)oxy]phenyl]methylideneamino]but-2-enedinitrile |
| SMILES | CC(C)(C)Oc1ccc(/C=N/C(C#N)=C(C#N)/N=C/c2ccc(OC(C)(C)C)cc2O)c(O)c1 |
| InChI | InChI=1S/C26H28N4O4/c1-25(2,3)33-19-9-7-17(23(31)11-19)15-29-21(13-27)22(14-28)30-16-18-8-10-20(12-24(18)32)34-26(4,5)6/h7-12,15-16,31-32H,1-6H3/b22-21?,29-15+,30-16+ |
| InChIKey | ZOSCVAPBPAVYBI-KIQHRPFLSA-N |
| XLogP | 5.25 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|