C29H30KNO9 — CID 158026644
potassium 3-[2-methoxy-4-[[2-methoxy-5-[(E)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenoxy]methyl]-5-nitrophenoxy]propanoate (PubChem CID 158026644) has the molecular formula C29H30KNO9 and a molecular weight of 575.66 g/mol. Its IUPAC name is potassium 3-[2-methoxy-4-[[2-methoxy-5-[(E)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenoxy]methyl]-5-nitrophenoxy]propanoate.
| Compound Name | potassium 3-[2-methoxy-4-[[2-methoxy-5-[(E)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenoxy]methyl]-5-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 158026644 |
| Molecular Formula | C29H30KNO9 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | potassium 3-[2-methoxy-4-[[2-methoxy-5-[(E)-2-(3-methoxy-4,5-dimethylphenyl)ethenyl]phenoxy]methyl]-5-nitrophenoxy]propanoate |
| SMILES | COc1cc(COc2cc(/C=C/c3cc(C)c(C)c(OC)c3)ccc2OC)c([N+](=O)[O-])cc1OCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C29H31NO9.K/c1-18-12-21(14-25(36-4)19(18)2)7-6-20-8-9-24(35-3)27(13-20)39-17-22-15-26(37-5)28(16-23(22)30(33)34)38-11-10-29(31)32;/h6-9,12-16H,10-11,17H2,1-5H3,(H,31,32);/q;+1/p-1/b7-6+; |
| InChIKey | JZILVWWWHLBDPJ-UHDJGPCESA-M |
| XLogP | 1.51 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|