C28H48O5Si — CID 158026748
5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-pentan-3-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 158026748) has the molecular formula C28H48O5Si and a molecular weight of 492.77 g/mol. Its IUPAC name is 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-pentan-3-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-pentan-3-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 158026748 |
| Molecular Formula | C28H48O5Si |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 5-[(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethyl-5-pentan-3-ylcyclohexene-1-carbonyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | CCC(CC)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C(C)=C(C(=O)C2=C(C)OC(C)(C)OC2=O)C1(C)C |
| InChI | InChI=1S/C28H48O5Si/c1-14-19(15-2)20-16-21(33-34(12,13)26(5,6)7)17(3)23(27(20,8)9)24(29)22-18(4)31-28(10,11)32-25(22)30/h19-21H,14-16H2,1-13H3/t20-,21-/m0/s1 |
| InChIKey | JGDNSOSCGMCSAI-SFTDATJTSA-N |
| XLogP | 7.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|