About CID 158028013
CID 158028013 (PubChem CID 158028013) has the molecular formula C46H57BBrN8O8
and a molecular weight of 940.73 g/mol.
Molecular Properties
| Compound Name | CID 158028013 |
| PubChem CID | 158028013 |
| Molecular Formula | C46H57BBrN8O8 |
| Molecular Weight | 940.73 g/mol |
| Exact Mass | 939.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(-c3ccc(O)cc3)cn3cncc23)CC1.CC(C)(C)OC(=O)N1CCC(Nc2cc(Br)cn3cncc23)CC1.O[B]Oc1ccc(O)cc1 |
| InChI | InChI=1S/C23H28N4O3.C17H23BrN4O2.C6H6BO3/c1-23(2,3)30-22(29)26-10-8-18(9-11-26)25-20-12-17(14-27-15-24-13-21(20)27)16-4-6-19(28)7-5-16;1-17(2,3)24-16(23)21-6-4-13(5-7-21)20-14-8-12(18)10-22-11-19-9-15(14)22;8-5-1-3-6(4-2-5)10-7-9/h4-7,12-15,18,25,28H,8-11H2,1-3H3;8-11,13,20H,4-7H2,1-3H3;1-4,8-9H |
| InChIKey | KWSQSVDROOHIPK-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 187.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 940.73 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158028013 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158028013?
The IUPAC name of CID 158028013 (CID 158028013) is not available.
What is the SMILES notation for CID 158028013?
The canonical SMILES for CID 158028013 is CC(C)(C)OC(=O)N1CCC(Nc2cc(-c3ccc(O)cc3)cn3cncc23)CC1.CC(C)(C)OC(=O)N1CCC(Nc2cc(Br)cn3cncc23)CC1.O[B]Oc1ccc(O)cc1.
What is the InChIKey of CID 158028013?
The InChIKey is KWSQSVDROOHIPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O3.C17H23BrN4O2.C6H6BO3/c1-23(2,3)30-22(29)26-10-8-18(9-11-26)25-20-12-17(14-27-15-24-13-21(20)27)16-4-6-19(28)7-5-16;1-17(2,3)24-16(23)21-6-4-13(5-7-21)20-14-8-12(18)10-22-11-19-9-15(14)22;8-5-1-3-6(4-2-5)10-7-9/h4-7,12-15,18,25,28H,8-11H2,1-3H3;8-11,13,20H,4-7H2,1-3H3;1-4,8-9H.
What are the key properties of CID 158028013?
CID 158028013 has a molecular weight of 940.73 g/mol, XLogP of 8.72, 7 rotatable bonds, 5 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158028013 is sourced from PubChem (CID 158028013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).