C22H28F3N3O2 — CID 158028042
N-methyl-N-[[(1R,3S,5R)-3-[2-[3-methyl-6-(trifluoromethyl)-2-pyridinyl]acetyl]-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide (PubChem CID 158028042) has the molecular formula C22H28F3N3O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is N-methyl-N-[[(1R,3S,5R)-3-[2-[3-methyl-6-(trifluoromethyl)-2-pyridinyl]acetyl]-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide.
| Compound Name | N-methyl-N-[[(1R,3S,5R)-3-[2-[3-methyl-6-(trifluoromethyl)-2-pyridinyl]acetyl]-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide |
|---|---|
| PubChem CID | 158028042 |
| Molecular Formula | C22H28F3N3O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-methyl-N-[[(1R,3S,5R)-3-[2-[3-methyl-6-(trifluoromethyl)-2-pyridinyl]acetyl]-2-azabicyclo[3.1.0]hexan-5-yl]methyl]hex-5-enamide |
| SMILES | C=CCCCC(=O)N(C)C[C@@]12C[C@@H](C(=O)Cc3nc(C(F)(F)F)ccc3C)N[C@@H]1C2 |
| InChI | InChI=1S/C22H28F3N3O2/c1-4-5-6-7-20(30)28(3)13-21-11-16(27-19(21)12-21)17(29)10-15-14(2)8-9-18(26-15)22(23,24)25/h4,8-9,16,19,27H,1,5-7,10-13H2,2-3H3/t16-,19+,21-/m0/s1 |
| InChIKey | NUBXZPFBCXJAGD-SCWSEQNSSA-N |
| XLogP | 3.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|