About 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one
6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one (PubChem CID 158028278) has the molecular formula C21H21ClO6
and a molecular weight of 404.85 g/mol. Its IUPAC name is 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one.
Molecular Properties
| Compound Name | 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one |
| PubChem CID | 158028278 |
| Molecular Formula | C21H21ClO6 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one |
| SMILES | COC1(c2c(Cl)c(O)cc3oc(=O)ccc23)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C21H21ClO6/c1-25-21(18-14-2-3-17(24)26-16(14)9-15(23)19(18)22)20(27-28-21)12-5-10-4-11(7-12)8-13(20)6-10/h2-3,9-13,23H,4-8H2,1H3 |
| InChIKey | VSHZWEJTIWUTAX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one?
The IUPAC name of 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one (CID 158028278) is 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one.
What is the SMILES notation for 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one?
The canonical SMILES for 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one is COC1(c2c(Cl)c(O)cc3oc(=O)ccc23)OOC12C1CC3CC(C1)CC2C3.
What is the InChIKey of 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one?
The InChIKey is VSHZWEJTIWUTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClO6/c1-25-21(18-14-2-3-17(24)26-16(14)9-15(23)19(18)22)20(27-28-21)12-5-10-4-11(7-12)8-13(20)6-10/h2-3,9-13,23H,4-8H2,1H3.
What are the key properties of 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one?
6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one has a molecular weight of 404.85 g/mol, XLogP of 4.11, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-hydroxy-5-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)chromen-2-one is sourced from PubChem (CID 158028278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).