C18H24N2O2S3 — CID 158028932
1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctane-1,7-dione (PubChem CID 158028932) has the molecular formula C18H24N2O2S3 and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctane-1,7-dione.
| Compound Name | 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctane-1,7-dione |
|---|---|
| PubChem CID | 158028932 |
| Molecular Formula | C18H24N2O2S3 |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctane-1,7-dione |
| SMILES | CC(C)Cc1sc(-c2nccs2)nc1C(=O)CCCCCC(=O)CS |
| InChI | InChI=1S/C18H24N2O2S3/c1-12(2)10-15-16(20-18(25-15)17-19-8-9-24-17)14(22)7-5-3-4-6-13(21)11-23/h8-9,12,23H,3-7,10-11H2,1-2H3 |
| InChIKey | WWFRCUQMCSGUHA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|