About N,N-dimethylethanamine;methane;2-methylprop-1-ene
N,N-dimethylethanamine;methane;2-methylprop-1-ene (PubChem CID 158029780) has the molecular formula C9H23N
and a molecular weight of 145.29 g/mol. Its IUPAC name is N,N-dimethylethanamine;methane;2-methylprop-1-ene.
Molecular Properties
| Compound Name | N,N-dimethylethanamine;methane;2-methylprop-1-ene |
| PubChem CID | 158029780 |
| Molecular Formula | C9H23N |
| Molecular Weight | 145.29 g/mol |
| Exact Mass | 145.18 |
| IUPAC Name | N,N-dimethylethanamine;methane;2-methylprop-1-ene |
| SMILES | C.C=C(C)C.CCN(C)C |
| InChI | InChI=1S/C4H11N.C4H8.CH4/c1-4-5(2)3;1-4(2)3;/h4H2,1-3H3;1H2,2-3H3;1H4 |
| InChIKey | FHATYMOHYAKECA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylethanamine;methane;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanamine;methane;2-methylprop-1-ene?
The IUPAC name of N,N-dimethylethanamine;methane;2-methylprop-1-ene (CID 158029780) is N,N-dimethylethanamine;methane;2-methylprop-1-ene.
What is the SMILES notation for N,N-dimethylethanamine;methane;2-methylprop-1-ene?
The canonical SMILES for N,N-dimethylethanamine;methane;2-methylprop-1-ene is C.C=C(C)C.CCN(C)C.
What is the InChIKey of N,N-dimethylethanamine;methane;2-methylprop-1-ene?
The InChIKey is FHATYMOHYAKECA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C4H8.CH4/c1-4-5(2)3;1-4(2)3;/h4H2,1-3H3;1H2,2-3H3;1H4.
What are the key properties of N,N-dimethylethanamine;methane;2-methylprop-1-ene?
N,N-dimethylethanamine;methane;2-methylprop-1-ene has a molecular weight of 145.29 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;methane;2-methylprop-1-ene is sourced from PubChem (CID 158029780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).