C38H38Cl2N4O4 — CID 158029999
4-[3,3-bis(4-chlorophenyl)propanoyl]piperazin-2-one;4-(3,3-diphenylpropanoyl)piperazin-2-one (PubChem CID 158029999) has the molecular formula C38H38Cl2N4O4 and a molecular weight of 685.65 g/mol. Its IUPAC name is 4-[3,3-bis(4-chlorophenyl)propanoyl]piperazin-2-one;4-(3,3-diphenylpropanoyl)piperazin-2-one.
| Compound Name | 4-[3,3-bis(4-chlorophenyl)propanoyl]piperazin-2-one;4-(3,3-diphenylpropanoyl)piperazin-2-one |
|---|---|
| PubChem CID | 158029999 |
| Molecular Formula | C38H38Cl2N4O4 |
| Molecular Weight | 685.65 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | 4-[3,3-bis(4-chlorophenyl)propanoyl]piperazin-2-one;4-(3,3-diphenylpropanoyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)CC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CCN1.O=C1CN(C(=O)CC(c2ccccc2)c2ccccc2)CCN1 |
| InChI | InChI=1S/C19H18Cl2N2O2.C19H20N2O2/c20-15-5-1-13(2-6-15)17(14-3-7-16(21)8-4-14)11-19(25)23-10-9-22-18(24)12-23;22-18-14-21(12-11-20-18)19(23)13-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-8,17H,9-12H2,(H,22,24);1-10,17H,11-14H2,(H,20,22) |
| InChIKey | FHBIZYGHTUREQR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |