C34H25ClF6N8O2 — CID 158030891
1-[3-(7-chloroimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-(7-ethynylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 158030891) has the molecular formula C34H25ClF6N8O2 and a molecular weight of 727.07 g/mol. Its IUPAC name is 1-[3-(7-chloroimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-(7-ethynylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-(7-chloroimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-(7-ethynylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 158030891 |
| Molecular Formula | C34H25ClF6N8O2 |
| Molecular Weight | 727.07 g/mol |
| Exact Mass | 726.17 |
| IUPAC Name | 1-[3-(7-chloroimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea;1-[3-(7-ethynylimidazo[1,2-a]pyridin-3-yl)phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | C#Cc1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1.O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3cc(Cl)ccn23)c1 |
| InChI | InChI=1S/C18H13F3N4O.C16H12ClF3N4O/c1-2-12-6-7-25-15(10-22-16(25)8-12)13-4-3-5-14(9-13)24-17(26)23-11-18(19,20)21;17-11-4-5-24-13(8-21-14(24)7-11)10-2-1-3-12(6-10)23-15(25)22-9-16(18,19)20/h1,3-10H,11H2,(H2,23,24,26);1-8H,9H2,(H2,22,23,25) |
| InChIKey | FHDXMSSMSWDHNZ-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.07 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|