C20H24N4O3 — CID 158031051
N-[2-[(6aR,7R,10aS)-9-isocyano-4-methoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]ethyl]acetamide (PubChem CID 158031051) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[2-[(6aR,7R,10aS)-9-isocyano-4-methoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]ethyl]acetamide.
| Compound Name | N-[2-[(6aR,7R,10aS)-9-isocyano-4-methoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 158031051 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[2-[(6aR,7R,10aS)-9-isocyano-4-methoxy-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]ethyl]acetamide |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(CCNC(C)=O)nc(OC)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C20H24N4O3/c1-11-14-7-6-13-18(20(14,3)10-15(21-4)17(11)26)23-16(24-19(13)27-5)8-9-22-12(2)25/h10-11,14H,6-9H2,1-3,5H3,(H,22,25)/t11-,14-,20-/m1/s1 |
| InChIKey | AABNVYGTBNNTCM-QRVQBPJGSA-N |
| XLogP | 2.01 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|