About 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one
6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one (PubChem CID 158031281) has the molecular formula C31H58N2O5
and a molecular weight of 538.81 g/mol. Its IUPAC name is 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one |
| PubChem CID | 158031281 |
| Molecular Formula | C31H58N2O5 |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.43 |
| IUPAC Name | 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one |
| SMILES | CCCCCCCC1CCCC(=O)O1.CCCCCCCCN1CCCC1=O.O=C1CCCN1CCCO |
| InChI | InChI=1S/C12H23NO.C12H22O2.C7H13NO2/c1-2-3-4-5-6-7-10-13-11-8-9-12(13)14;1-2-3-4-5-6-8-11-9-7-10-12(13)14-11;9-6-2-5-8-4-1-3-7(8)10/h2-11H2,1H3;11H,2-10H2,1H3;9H,1-6H2 |
| InChIKey | FHEXROYEDGMCKN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one?
The IUPAC name of 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one (CID 158031281) is 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one.
What is the SMILES notation for 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one?
The canonical SMILES for 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one is CCCCCCCC1CCCC(=O)O1.CCCCCCCCN1CCCC1=O.O=C1CCCN1CCCO.
What is the InChIKey of 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one?
The InChIKey is FHEXROYEDGMCKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO.C12H22O2.C7H13NO2/c1-2-3-4-5-6-7-10-13-11-8-9-12(13)14;1-2-3-4-5-6-8-11-9-7-10-12(13)14-11;9-6-2-5-8-4-1-3-7(8)10/h2-11H2,1H3;11H,2-10H2,1H3;9H,1-6H2.
What are the key properties of 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one?
6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one has a molecular weight of 538.81 g/mol, XLogP of 6.40, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-heptyloxan-2-one;1-(3-hydroxypropyl)pyrrolidin-2-one;1-octylpyrrolidin-2-one is sourced from PubChem (CID 158031281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).