C13H30ClNO2 — CID 158031583
2-(2-hydroxyethoxy)ethyl-methyl-octylazanium chloride (PubChem CID 158031583) has the molecular formula C13H30ClNO2 and a molecular weight of 267.84 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl-methyl-octylazanium chloride.
| Compound Name | 2-(2-hydroxyethoxy)ethyl-methyl-octylazanium chloride |
|---|---|
| PubChem CID | 158031583 |
| Molecular Formula | C13H30ClNO2 |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl-methyl-octylazanium chloride |
| SMILES | CCCCCCCC[NH+](C)CCOCCO.[Cl-] |
| InChI | InChI=1S/C13H29NO2.ClH/c1-3-4-5-6-7-8-9-14(2)10-12-16-13-11-15;/h15H,3-13H2,1-2H3;1H |
| InChIKey | QMNODTZPRVUMAM-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|