About indol-2-one;prop-2-enamide
indol-2-one;prop-2-enamide (PubChem CID 158033348) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is indol-2-one;prop-2-enamide.
Molecular Properties
| Compound Name | indol-2-one;prop-2-enamide |
| PubChem CID | 158033348 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | indol-2-one;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H5NO.C3H5NO/c10-8-5-6-3-1-2-4-7(6)9-8;1-2-3(4)5/h1-5H;2H,1H2,(H2,4,5) |
| InChIKey | FHLHNMGLEJVEQI-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze indol-2-one;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-one;prop-2-enamide?
The IUPAC name of indol-2-one;prop-2-enamide (CID 158033348) is indol-2-one;prop-2-enamide.
What is the SMILES notation for indol-2-one;prop-2-enamide?
The canonical SMILES for indol-2-one;prop-2-enamide is C=CC(N)=O.O=C1C=c2ccccc2=N1.
What is the InChIKey of indol-2-one;prop-2-enamide?
The InChIKey is FHLHNMGLEJVEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.C3H5NO/c10-8-5-6-3-1-2-4-7(6)9-8;1-2-3(4)5/h1-5H;2H,1H2,(H2,4,5).
What are the key properties of indol-2-one;prop-2-enamide?
indol-2-one;prop-2-enamide has a molecular weight of 202.21 g/mol, XLogP of -0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-one;prop-2-enamide is sourced from PubChem (CID 158033348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).