About phenylmethanimine;2H-tetrazole
phenylmethanimine;2H-tetrazole (PubChem CID 158034084) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is phenylmethanimine;2H-tetrazole.
Molecular Properties
| Compound Name | phenylmethanimine;2H-tetrazole |
| PubChem CID | 158034084 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | phenylmethanimine;2H-tetrazole |
| SMILES | [H]/N=C/c1ccccc1.c1nn[nH]n1 |
| InChI | InChI=1S/C7H7N.CH2N4/c8-6-7-4-2-1-3-5-7;1-2-4-5-3-1/h1-6,8H;1H,(H,2,3,4,5)/b8-6+; |
| InChIKey | FHNMPCCUMHHXQY-WVLIHFOGSA-N |
| XLogP | 0.88 |
| TPSA | 78.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanimine;2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanimine;2H-tetrazole?
The IUPAC name of phenylmethanimine;2H-tetrazole (CID 158034084) is phenylmethanimine;2H-tetrazole.
What is the SMILES notation for phenylmethanimine;2H-tetrazole?
The canonical SMILES for phenylmethanimine;2H-tetrazole is [H]/N=C/c1ccccc1.c1nn[nH]n1.
What is the InChIKey of phenylmethanimine;2H-tetrazole?
The InChIKey is FHNMPCCUMHHXQY-WVLIHFOGSA-N. The full InChI is InChI=1S/C7H7N.CH2N4/c8-6-7-4-2-1-3-5-7;1-2-4-5-3-1/h1-6,8H;1H,(H,2,3,4,5)/b8-6+;.
What are the key properties of phenylmethanimine;2H-tetrazole?
phenylmethanimine;2H-tetrazole has a molecular weight of 175.19 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanimine;2H-tetrazole is sourced from PubChem (CID 158034084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).