C22H34O10 — CID 158035076
dimethyl 3-ethyl-5-methyloxane-3,5-dicarboxylate;methyl 2-(2-methoxycarbonylprop-2-enoxymethyl)prop-2-enoate (PubChem CID 158035076) has the molecular formula C22H34O10 and a molecular weight of 458.50 g/mol. Its IUPAC name is dimethyl 3-ethyl-5-methyloxane-3,5-dicarboxylate;methyl 2-(2-methoxycarbonylprop-2-enoxymethyl)prop-2-enoate.
| Compound Name | dimethyl 3-ethyl-5-methyloxane-3,5-dicarboxylate;methyl 2-(2-methoxycarbonylprop-2-enoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 158035076 |
| Molecular Formula | C22H34O10 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | dimethyl 3-ethyl-5-methyloxane-3,5-dicarboxylate;methyl 2-(2-methoxycarbonylprop-2-enoxymethyl)prop-2-enoate |
| SMILES | C=C(COCC(=C)C(=O)OC)C(=O)OC.CCC1(C(=O)OC)COCC(C)(C(=O)OC)C1 |
| InChI | InChI=1S/C12H20O5.C10H14O5/c1-5-12(10(14)16-4)6-11(2,7-17-8-12)9(13)15-3;1-7(9(11)13-3)5-15-6-8(2)10(12)14-4/h5-8H2,1-4H3;1-2,5-6H2,3-4H3 |
| InChIKey | FHQLZABADZGXFH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|