About 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride
2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride (PubChem CID 158035120) has the molecular formula C19H13BrCl3NO3S
and a molecular weight of 521.65 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride |
| PubChem CID | 158035120 |
| Molecular Formula | C19H13BrCl3NO3S |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 518.89 |
| IUPAC Name | 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(Cc2c(Cl)cc(Br)cc2Cl)ncc1OCc1ccccc1 |
| InChI | InChI=1S/C19H13BrCl3NO3S/c20-13-6-16(21)15(17(22)7-13)8-14-9-19(28(23,25)26)18(10-24-14)27-11-12-4-2-1-3-5-12/h1-7,9-10H,8,11H2 |
| InChIKey | GGAAZPPCLGDBLX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride?
The IUPAC name of 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride (CID 158035120) is 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride.
What is the SMILES notation for 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride?
The canonical SMILES for 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride is O=S(=O)(Cl)c1cc(Cc2c(Cl)cc(Br)cc2Cl)ncc1OCc1ccccc1.
What is the InChIKey of 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride?
The InChIKey is GGAAZPPCLGDBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13BrCl3NO3S/c20-13-6-16(21)15(17(22)7-13)8-14-9-19(28(23,25)26)18(10-24-14)27-11-12-4-2-1-3-5-12/h1-7,9-10H,8,11H2.
What are the key properties of 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride?
2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride has a molecular weight of 521.65 g/mol, XLogP of 6.25, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxypyridine-4-sulfonyl chloride is sourced from PubChem (CID 158035120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).