C19H22O6 — CID 158036349
2,2-dideuterio-3-[3-(methoxymethoxy)phenyl]oxirane;3-(methoxymethoxy)benzaldehyde (PubChem CID 158036349) has the molecular formula C19H22O6 and a molecular weight of 348.39 g/mol. Its IUPAC name is 2,2-dideuterio-3-[3-(methoxymethoxy)phenyl]oxirane;3-(methoxymethoxy)benzaldehyde.
| Compound Name | 2,2-dideuterio-3-[3-(methoxymethoxy)phenyl]oxirane;3-(methoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 158036349 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2,2-dideuterio-3-[3-(methoxymethoxy)phenyl]oxirane;3-(methoxymethoxy)benzaldehyde |
| SMILES | COCOc1cccc(C=O)c1.[2H]C1([2H])OC1c1cccc(OCOC)c1 |
| InChI | InChI=1S/C10H12O3.C9H10O3/c1-11-7-13-9-4-2-3-8(5-9)10-6-12-10;1-11-7-12-9-4-2-3-8(5-9)6-10/h2-5,10H,6-7H2,1H3;2-6H,7H2,1H3/i6D2; |
| InChIKey | FHUGSKFHOHNNAL-GZEMNZGQSA-N |
| XLogP | 3.22 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|