C10H14F3N3OS — CID 158036361
5-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-amine;2,2,2-trifluoroacetaldehyde (PubChem CID 158036361) has the molecular formula C10H14F3N3OS and a molecular weight of 281.30 g/mol. Its IUPAC name is 5-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-amine;2,2,2-trifluoroacetaldehyde.
| Compound Name | 5-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-amine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158036361 |
| Molecular Formula | C10H14F3N3OS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-(pyrrolidin-1-ylmethyl)-1,3-thiazol-2-amine;2,2,2-trifluoroacetaldehyde |
| SMILES | Nc1ncc(CN2CCCC2)s1.O=CC(F)(F)F |
| InChI | InChI=1S/C8H13N3S.C2HF3O/c9-8-10-5-7(12-8)6-11-3-1-2-4-11;3-2(4,5)1-6/h5H,1-4,6H2,(H2,9,10);1H |
| InChIKey | FHUHGTKUVZJDMG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|