C12H14F6O4 — CID 158036379
2-ethoxy-1,1,1-trifluoropent-3-yn-2-ol;1,1,1-trifluoropent-3-yne-2,2-diol (PubChem CID 158036379) has the molecular formula C12H14F6O4 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-ethoxy-1,1,1-trifluoropent-3-yn-2-ol;1,1,1-trifluoropent-3-yne-2,2-diol.
| Compound Name | 2-ethoxy-1,1,1-trifluoropent-3-yn-2-ol;1,1,1-trifluoropent-3-yne-2,2-diol |
|---|---|
| PubChem CID | 158036379 |
| Molecular Formula | C12H14F6O4 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-ethoxy-1,1,1-trifluoropent-3-yn-2-ol;1,1,1-trifluoropent-3-yne-2,2-diol |
| SMILES | CC#CC(O)(O)C(F)(F)F.CC#CC(O)(OCC)C(F)(F)F |
| InChI | InChI=1S/C7H9F3O2.C5H5F3O2/c1-3-5-6(11,12-4-2)7(8,9)10;1-2-3-4(9,10)5(6,7)8/h11H,4H2,1-2H3;9-10H,1H3 |
| InChIKey | FHUIICTWRSUJND-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|