C13H17N7O — CID 158036810
N'-methanimidoyl-N-methyl-N-[7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazin-4-yl]methanimidamide (PubChem CID 158036810) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is N'-methanimidoyl-N-methyl-N-[7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazin-4-yl]methanimidamide.
| Compound Name | N'-methanimidoyl-N-methyl-N-[7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazin-4-yl]methanimidamide |
|---|---|
| PubChem CID | 158036810 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N'-methanimidoyl-N-methyl-N-[7-methyl-5-[(3S)-oxolan-3-yl]imidazo[5,1-f][1,2,4]triazin-4-yl]methanimidamide |
| SMILES | [H]/N=C/N=C/N(C)c1ncnn2c(C)nc([C@@H]3CCOC3)c12 |
| InChI | InChI=1S/C13H17N7O/c1-9-18-11(10-3-4-21-5-10)12-13(16-7-17-20(9)12)19(2)8-15-6-14/h6-8,10,14H,3-5H2,1-2H3/b14-6+,15-8+/t10-/m1/s1 |
| InChIKey | FHVRDOBBHJKIOO-HJTGSQMTSA-N |
| XLogP | 1.01 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|