C36H75N3 — CID 158037935
1,3-ditert-butylazetidine;1,4-ditert-butylpiperidine;1,3-ditert-butylpyrrolidine (PubChem CID 158037935) has the molecular formula C36H75N3 and a molecular weight of 550.02 g/mol. Its IUPAC name is 1,3-ditert-butylazetidine;1,4-ditert-butylpiperidine;1,3-ditert-butylpyrrolidine.
| Compound Name | 1,3-ditert-butylazetidine;1,4-ditert-butylpiperidine;1,3-ditert-butylpyrrolidine |
|---|---|
| PubChem CID | 158037935 |
| Molecular Formula | C36H75N3 |
| Molecular Weight | 550.02 g/mol |
| Exact Mass | 549.60 |
| IUPAC Name | 1,3-ditert-butylazetidine;1,4-ditert-butylpiperidine;1,3-ditert-butylpyrrolidine |
| SMILES | CC(C)(C)C1CCN(C(C)(C)C)C1.CC(C)(C)C1CCN(C(C)(C)C)CC1.CC(C)(C)C1CN(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H27N.C12H25N.C11H23N/c1-12(2,3)11-7-9-14(10-8-11)13(4,5)6;1-11(2,3)10-7-8-13(9-10)12(4,5)6;1-10(2,3)9-7-12(8-9)11(4,5)6/h11H,7-10H2,1-6H3;10H,7-9H2,1-6H3;9H,7-8H2,1-6H3 |
| InChIKey | FHZKYHVCECOPEK-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.02 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |