C31H28F9NO5P- — CID 158038518
9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-10-[3-methoxy-5-(trifluoromethyl)phenyl]-9H-acridine hexafluorophosphate (PubChem CID 158038518) has the molecular formula C31H28F9NO5P- and a molecular weight of 696.52 g/mol. Its IUPAC name is 9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-10-[3-methoxy-5-(trifluoromethyl)phenyl]-9H-acridine hexafluorophosphate.
| Compound Name | 9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-10-[3-methoxy-5-(trifluoromethyl)phenyl]-9H-acridine hexafluorophosphate |
|---|---|
| PubChem CID | 158038518 |
| Molecular Formula | C31H28F9NO5P- |
| Molecular Weight | 696.52 g/mol |
| Exact Mass | 696.16 |
| IUPAC Name | 9-(2,6-dimethoxyphenyl)-1,8-dimethoxy-10-[3-methoxy-5-(trifluoromethyl)phenyl]-9H-acridine hexafluorophosphate |
| SMILES | COc1cc(N2c3cccc(OC)c3C(c3c(OC)cccc3OC)c3c(OC)cccc32)cc(C(F)(F)F)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C31H28F3NO5.F6P/c1-36-20-16-18(31(32,33)34)15-19(17-20)35-21-9-6-11-23(37-2)27(21)30(28-22(35)10-7-12-24(28)38-3)29-25(39-4)13-8-14-26(29)40-5;1-7(2,3,4,5)6/h6-17,30H,1-5H3;/q;-1 |
| InChIKey | ZTMJFLKXUHVHAK-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.52 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|