C28H28N2O7S — CID 158039327
3-[3-[(2S)-6-(3-methoxyphenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]propoxy]-4H-1,2-oxazol-5-one (PubChem CID 158039327) has the molecular formula C28H28N2O7S and a molecular weight of 536.61 g/mol. Its IUPAC name is 3-[3-[(2S)-6-(3-methoxyphenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]propoxy]-4H-1,2-oxazol-5-one.
| Compound Name | 3-[3-[(2S)-6-(3-methoxyphenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]propoxy]-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 158039327 |
| Molecular Formula | C28H28N2O7S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 3-[3-[(2S)-6-(3-methoxyphenyl)-4-(3-methylphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]propoxy]-4H-1,2-oxazol-5-one |
| SMILES | COc1cccc(-c2ccc3c(c2)N(S(=O)(=O)c2cccc(C)c2)C[C@H](CCCOC2=NOC(=O)C2)O3)c1 |
| InChI | InChI=1S/C28H28N2O7S/c1-19-6-3-10-24(14-19)38(32,33)30-18-23(9-5-13-35-27-17-28(31)37-29-27)36-26-12-11-21(16-25(26)30)20-7-4-8-22(15-20)34-2/h3-4,6-8,10-12,14-16,23H,5,9,13,17-18H2,1-2H3/t23-/m0/s1 |
| InChIKey | FIDSIOOXLCZJAP-QHCPKHFHSA-N |
| XLogP | 4.68 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|