About diphenylphosphane;1-phenyl-9H-carbazole
diphenylphosphane;1-phenyl-9H-carbazole (PubChem CID 158040187) has the molecular formula C30H24NP
and a molecular weight of 429.50 g/mol. Its IUPAC name is diphenylphosphane;1-phenyl-9H-carbazole.
Molecular Properties
| Compound Name | diphenylphosphane;1-phenyl-9H-carbazole |
| PubChem CID | 158040187 |
| Molecular Formula | C30H24NP |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | diphenylphosphane;1-phenyl-9H-carbazole |
| SMILES | c1ccc(-c2cccc3c2[nH]c2ccccc23)cc1.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C18H13N.C12H11P/c1-2-7-13(8-3-1)14-10-6-11-16-15-9-4-5-12-17(15)19-18(14)16;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-12,19H;1-10,13H |
| InChIKey | FIGIYVVQJFUHBO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;1-phenyl-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;1-phenyl-9H-carbazole?
The IUPAC name of diphenylphosphane;1-phenyl-9H-carbazole (CID 158040187) is diphenylphosphane;1-phenyl-9H-carbazole.
What is the SMILES notation for diphenylphosphane;1-phenyl-9H-carbazole?
The canonical SMILES for diphenylphosphane;1-phenyl-9H-carbazole is c1ccc(-c2cccc3c2[nH]c2ccccc23)cc1.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;1-phenyl-9H-carbazole?
The InChIKey is FIGIYVVQJFUHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N.C12H11P/c1-2-7-13(8-3-1)14-10-6-11-16-15-9-4-5-12-17(15)19-18(14)16;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-12,19H;1-10,13H.
What are the key properties of diphenylphosphane;1-phenyl-9H-carbazole?
diphenylphosphane;1-phenyl-9H-carbazole has a molecular weight of 429.50 g/mol, XLogP of 7.30, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;1-phenyl-9H-carbazole is sourced from PubChem (CID 158040187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).