About hafnium;triethylphosphane
hafnium;triethylphosphane (PubChem CID 158040636) has the molecular formula C6H15HfP
and a molecular weight of 296.65 g/mol. Its IUPAC name is hafnium;triethylphosphane.
Molecular Properties
| Compound Name | hafnium;triethylphosphane |
| PubChem CID | 158040636 |
| Molecular Formula | C6H15HfP |
| Molecular Weight | 296.65 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | hafnium;triethylphosphane |
| SMILES | CCP(CC)CC.[Hf] |
| InChI | InChI=1S/C6H15P.Hf/c1-4-7(5-2)6-3;/h4-6H2,1-3H3; |
| InChIKey | FIHSBWYXXGANPZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hafnium;triethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;triethylphosphane?
The IUPAC name of hafnium;triethylphosphane (CID 158040636) is hafnium;triethylphosphane.
What is the SMILES notation for hafnium;triethylphosphane?
The canonical SMILES for hafnium;triethylphosphane is CCP(CC)CC.[Hf].
What is the InChIKey of hafnium;triethylphosphane?
The InChIKey is FIHSBWYXXGANPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P.Hf/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;.
What are the key properties of hafnium;triethylphosphane?
hafnium;triethylphosphane has a molecular weight of 296.65 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;triethylphosphane is sourced from PubChem (CID 158040636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).