C24H27F2N3O8S — CID 158040718
(E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[(2S,4S,5R)-4,5,6-trihydroxyoxan-2-yl]ethylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide (PubChem CID 158040718) has the molecular formula C24H27F2N3O8S and a molecular weight of 555.56 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[(2S,4S,5R)-4,5,6-trihydroxyoxan-2-yl]ethylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[(2S,4S,5R)-4,5,6-trihydroxyoxan-2-yl]ethylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 158040718 |
| Molecular Formula | C24H27F2N3O8S |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[(2S,4S,5R)-4,5,6-trihydroxyoxan-2-yl]ethylsulfonyl]phenoxy]phenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)CC[C@@H]3C[C@H](O)[C@@H](O)C(O)O3)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C24H27F2N3O8S/c1-12(22(32)29-24(27)28)8-13-9-17(25)21(18(26)10-13)36-14-2-4-16(5-3-14)38(34,35)7-6-15-11-19(30)20(31)23(33)37-15/h2-5,8-10,15,19-20,23,30-31,33H,6-7,11H2,1H3,(H4,27,28,29,32)/b12-8+/t15-,19+,20-,23?/m1/s1 |
| InChIKey | LDNGZLSVNROEKC-JLFSHKSHSA-N |
| XLogP | 0.95 |
| TPSA | 194.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|