C24H20F2N4O4 — CID 158040940
(15R)-21-fluoro-10-(5-fluoro-3-methyl-2-pyridinyl)-13,17-dioxa-5,7,8-triazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene;formic acid (PubChem CID 158040940) has the molecular formula C24H20F2N4O4 and a molecular weight of 466.44 g/mol. Its IUPAC name is (15R)-21-fluoro-10-(5-fluoro-3-methyl-2-pyridinyl)-13,17-dioxa-5,7,8-triazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene;formic acid.
| Compound Name | (15R)-21-fluoro-10-(5-fluoro-3-methyl-2-pyridinyl)-13,17-dioxa-5,7,8-triazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene;formic acid |
|---|---|
| PubChem CID | 158040940 |
| Molecular Formula | C24H20F2N4O4 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (15R)-21-fluoro-10-(5-fluoro-3-methyl-2-pyridinyl)-13,17-dioxa-5,7,8-triazapentacyclo[13.6.1.04,12.05,9.018,22]docosa-1(21),4(12),6,8,10,18(22),19-heptaene;formic acid |
| SMILES | Cc1cc(F)cnc1-c1cc2c(n3cnnc13)CCc1c(F)ccc3c1[C@H](CO3)CO2.O=CO |
| InChI | InChI=1S/C23H18F2N4O2.CH2O2/c1-12-6-14(24)8-26-22(12)16-7-20-18(29-11-27-28-23(16)29)4-2-15-17(25)3-5-19-21(15)13(9-30-19)10-31-20;2-1-3/h3,5-8,11,13H,2,4,9-10H2,1H3;1H,(H,2,3)/t13-;/m1./s1 |
| InChIKey | FIIPATUWUSQAEK-BTQNPOSSSA-N |
| XLogP | 3.73 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|