About azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide
azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide (PubChem CID 158041104) has the molecular formula C14H21N5O5S
and a molecular weight of 371.42 g/mol. Its IUPAC name is azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide.
Molecular Properties
| Compound Name | azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide |
| PubChem CID | 158041104 |
| Molecular Formula | C14H21N5O5S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide |
| SMILES | N.[H]/N=C(C(=O)NO)/C(=N\[H])S(=O)(=O)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C14H18N4O5S.H3N/c15-12(14(19)17-20)13(16)24(21,22)18-8-6-11(7-9-18)23-10-4-2-1-3-5-10;/h1-5,11,15-16,20H,6-9H2,(H,17,19);1H3/b15-12-,16-13+; |
| InChIKey | FRJNZZSLAHKDRF-XQHYRYMUSA-N |
| XLogP | 0.52 |
| TPSA | 178.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide?
The IUPAC name of azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide (CID 158041104) is azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide.
What is the SMILES notation for azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide?
The canonical SMILES for azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide is N.[H]/N=C(C(=O)NO)/C(=N\[H])S(=O)(=O)N1CCC(Oc2ccccc2)CC1.
What is the InChIKey of azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide?
The InChIKey is FRJNZZSLAHKDRF-XQHYRYMUSA-N. The full InChI is InChI=1S/C14H18N4O5S.H3N/c15-12(14(19)17-20)13(16)24(21,22)18-8-6-11(7-9-18)23-10-4-2-1-3-5-10;/h1-5,11,15-16,20H,6-9H2,(H,17,19);1H3/b15-12-,16-13+;.
What are the key properties of azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide?
azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide has a molecular weight of 371.42 g/mol, XLogP of 0.52, 5 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-hydroxy-2,3-diimino-3-(4-phenoxypiperidin-1-yl)sulfonylpropanamide is sourced from PubChem (CID 158041104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).