About 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine
2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine (PubChem CID 158042342) has the molecular formula C20H31ClN6O2
and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine.
Molecular Properties
| Compound Name | 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine |
| PubChem CID | 158042342 |
| Molecular Formula | C20H31ClN6O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine |
| SMILES | C1CNCCN1.COc1cccc(N2CCNCC2)n1.COc1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H15N3O.C6H6ClNO.C4H10N2/c1-14-10-4-2-3-9(12-10)13-7-5-11-6-8-13;1-9-5-2-3-8-6(7)4-5;1-2-6-4-3-5-1/h2-4,11H,5-8H2,1H3;2-4H,1H3;5-6H,1-4H2 |
| InChIKey | FIMSUELWHNILHF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine?
The IUPAC name of 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine (CID 158042342) is 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine.
What is the SMILES notation for 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine?
The canonical SMILES for 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine is C1CNCCN1.COc1cccc(N2CCNCC2)n1.COc1ccnc(Cl)c1.
What is the InChIKey of 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine?
The InChIKey is FIMSUELWHNILHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O.C6H6ClNO.C4H10N2/c1-14-10-4-2-3-9(12-10)13-7-5-11-6-8-13;1-9-5-2-3-8-6(7)4-5;1-2-6-4-3-5-1/h2-4,11H,5-8H2,1H3;2-4H,1H3;5-6H,1-4H2.
What are the key properties of 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine?
2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine has a molecular weight of 422.96 g/mol, XLogP of 1.42, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methoxypyridine;1-(6-methoxy-2-pyridinyl)piperazine;piperazine is sourced from PubChem (CID 158042342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).