C27H23FN4O — CID 158043326
4-[(5aR,6R,10aR)-3-(2-fluorophenyl)-6,10a-dimethyl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazol-1-yl]benzonitrile (PubChem CID 158043326) has the molecular formula C27H23FN4O and a molecular weight of 438.51 g/mol. Its IUPAC name is 4-[(5aR,6R,10aR)-3-(2-fluorophenyl)-6,10a-dimethyl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazol-1-yl]benzonitrile.
| Compound Name | 4-[(5aR,6R,10aR)-3-(2-fluorophenyl)-6,10a-dimethyl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 158043326 |
| Molecular Formula | C27H23FN4O |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 4-[(5aR,6R,10aR)-3-(2-fluorophenyl)-6,10a-dimethyl-5,5a,6,10-tetrahydro-4H-indazolo[7,6-f][1,2]benzoxazol-1-yl]benzonitrile |
| SMILES | C[C@H]1c2oncc2C[C@@]2(C)c3c(c(-c4ccccc4F)nn3-c3ccc(C#N)cc3)CC[C@H]12 |
| InChI | InChI=1S/C27H23FN4O/c1-16-22-12-11-21-24(20-5-3-4-6-23(20)28)31-32(19-9-7-17(14-29)8-10-19)26(21)27(22,2)13-18-15-30-33-25(16)18/h3-10,15-16,22H,11-13H2,1-2H3/t16-,22-,27-/m1/s1 |
| InChIKey | DLPBOTAMWBHLQR-KRLBWHOLSA-N |
| XLogP | 5.72 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |