C25H22F2N4O2 — CID 158043367
[(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone (PubChem CID 158043367) has the molecular formula C25H22F2N4O2 and a molecular weight of 448.47 g/mol. Its IUPAC name is [(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone.
| Compound Name | [(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone |
|---|---|
| PubChem CID | 158043367 |
| Molecular Formula | C25H22F2N4O2 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(2-methyl-1,3-benzoxazol-6-yl)methanone |
| SMILES | Cc1nc2ccc(C(=O)N3[C@@H]4CCC[C@H]3c3nn(C)c(-c5cc(F)cc(F)c5)c3C4)cc2o1 |
| InChI | InChI=1S/C25H22F2N4O2/c1-13-28-20-7-6-14(10-22(20)33-13)25(32)31-18-4-3-5-21(31)23-19(12-18)24(30(2)29-23)15-8-16(26)11-17(27)9-15/h6-11,18,21H,3-5,12H2,1-2H3/t18-,21+/m1/s1 |
| InChIKey | FIPULPHGBVGPAU-NQIIRXRSSA-N |
| XLogP | 5.11 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |